C17H12ClN2O2S- — CID 6936271
3-amino-4-(4-chlorophenyl)-6-cyclopropylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 6936271) has the molecular formula C17H12ClN2O2S- and a molecular weight of 343.82 g/mol. Its IUPAC name is 3-amino-4-(4-chlorophenyl)-6-cyclopropylthieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | 3-amino-4-(4-chlorophenyl)-6-cyclopropylthieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 6936271 |
| Molecular Formula | C17H12ClN2O2S- |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-amino-4-(4-chlorophenyl)-6-cyclopropylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | Nc1c(C(=O)[O-])sc2nc(C3CC3)cc(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C17H13ClN2O2S/c18-10-5-3-8(4-6-10)11-7-12(9-1-2-9)20-16-13(11)14(19)15(23-16)17(21)22/h3-7,9H,1-2,19H2,(H,21,22)/p-1 |
| InChIKey | HGXZBFMGOXOOFP-UHFFFAOYSA-M |
| XLogP | 3.44 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_D(2)', 'substructure': 'N/A'} |
|---|