C24H24N4O5 — CID 69366219
[4-[[2-(oxan-4-ylmethylcarbamoyl)-3-pyridinyl]carbamoyl]naphthalen-1-yl]carbamic acid (PubChem CID 69366219) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is [4-[[2-(oxan-4-ylmethylcarbamoyl)-3-pyridinyl]carbamoyl]naphthalen-1-yl]carbamic acid.
| Compound Name | [4-[[2-(oxan-4-ylmethylcarbamoyl)-3-pyridinyl]carbamoyl]naphthalen-1-yl]carbamic acid |
|---|---|
| PubChem CID | 69366219 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | [4-[[2-(oxan-4-ylmethylcarbamoyl)-3-pyridinyl]carbamoyl]naphthalen-1-yl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(C(=O)Nc2cccnc2C(=O)NCC2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C24H24N4O5/c29-22(18-7-8-19(28-24(31)32)17-5-2-1-4-16(17)18)27-20-6-3-11-25-21(20)23(30)26-14-15-9-12-33-13-10-15/h1-8,11,15,28H,9-10,12-14H2,(H,26,30)(H,27,29)(H,31,32) |
| InChIKey | FBLUGHMCGMGPPU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |