C27H32N6O2 — CID 143144363
3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-N-(cyclohexylmethyl)pyridine-2-carboxamide (PubChem CID 143144363) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-N-(cyclohexylmethyl)pyridine-2-carboxamide.
| Compound Name | 3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-N-(cyclohexylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143144363 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-N-(cyclohexylmethyl)pyridine-2-carboxamide |
| SMILES | N/C=C\N(N)Cc1ccc(C(=O)Nc2cccnc2C(=O)NCC2CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C27H32N6O2/c28-14-16-33(29)18-20-12-13-23(22-10-5-4-9-21(20)22)26(34)32-24-11-6-15-30-25(24)27(35)31-17-19-7-2-1-3-8-19/h4-6,9-16,19H,1-3,7-8,17-18,28-29H2,(H,31,35)(H,32,34)/b16-14- |
| InChIKey | GEQFKVHVGLEBPC-PEZBUJJGSA-N |
| XLogP | 3.90 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|