C30H38N6O6 — CID 143467857
3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-6-[2-(2-hydroxyethoxy)ethoxy]-N-(oxan-4-ylmethyl)pyridine-2-carboxamide (PubChem CID 143467857) has the molecular formula C30H38N6O6 and a molecular weight of 578.67 g/mol. Its IUPAC name is 3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-6-[2-(2-hydroxyethoxy)ethoxy]-N-(oxan-4-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-6-[2-(2-hydroxyethoxy)ethoxy]-N-(oxan-4-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143467857 |
| Molecular Formula | C30H38N6O6 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | 3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-6-[2-(2-hydroxyethoxy)ethoxy]-N-(oxan-4-ylmethyl)pyridine-2-carboxamide |
| SMILES | N/C=C\N(N)Cc1ccc(C(=O)Nc2ccc(OCCOCCO)nc2C(=O)NCC2CCOCC2)c2ccccc12 |
| InChI | InChI=1S/C30H38N6O6/c31-11-12-36(32)20-22-5-6-25(24-4-2-1-3-23(22)24)29(38)34-26-7-8-27(42-18-17-41-16-13-37)35-28(26)30(39)33-19-21-9-14-40-15-10-21/h1-8,11-12,21,37H,9-10,13-20,31-32H2,(H,33,39)(H,34,38)/b12-11- |
| InChIKey | KXWIGERZOUMDFH-QXMHVHEDSA-N |
| XLogP | 2.14 |
| TPSA | 174.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|