C30H38N6O3 — CID 143144400
3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-N-(cyclohexylmethyl)-6-propoxypyridine-2-carboxamide (PubChem CID 143144400) has the molecular formula C30H38N6O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is 3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-N-(cyclohexylmethyl)-6-propoxypyridine-2-carboxamide.
| Compound Name | 3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-N-(cyclohexylmethyl)-6-propoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 143144400 |
| Molecular Formula | C30H38N6O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 3-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-N-(cyclohexylmethyl)-6-propoxypyridine-2-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)c2ccc(CN(N)/C=C\N)c3ccccc23)c(C(=O)NCC2CCCCC2)n1 |
| InChI | InChI=1S/C30H38N6O3/c1-2-18-39-27-15-14-26(28(35-27)30(38)33-19-21-8-4-3-5-9-21)34-29(37)25-13-12-22(20-36(32)17-16-31)23-10-6-7-11-24(23)25/h6-7,10-17,21H,2-5,8-9,18-20,31-32H2,1H3,(H,33,38)(H,34,37)/b17-16- |
| InChIKey | HMODGDMTXKXTAO-MSUUIHNZSA-N |
| XLogP | 4.69 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|