C25H28N4O2 — CID 58973371
N-(cyclohexylmethyl)-3-[(4-ethylnaphthalene-1-carbonyl)amino]pyrazine-2-carboxamide (PubChem CID 58973371) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3-[(4-ethylnaphthalene-1-carbonyl)amino]pyrazine-2-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-3-[(4-ethylnaphthalene-1-carbonyl)amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58973371 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-(cyclohexylmethyl)-3-[(4-ethylnaphthalene-1-carbonyl)amino]pyrazine-2-carboxamide |
| SMILES | CCc1ccc(C(=O)Nc2nccnc2C(=O)NCC2CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C25H28N4O2/c1-2-18-12-13-21(20-11-7-6-10-19(18)20)24(30)29-23-22(26-14-15-27-23)25(31)28-16-17-8-4-3-5-9-17/h6-7,10-15,17H,2-5,8-9,16H2,1H3,(H,28,31)(H,27,29,30) |
| InChIKey | XVXSCGILKDLJDI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |