C34H48N6O5 — CID 143467864
ethane;methyl 2-[[5-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-6-(cyclohexylmethylcarbamoyl)-2-pyridinyl]oxy]acetate (PubChem CID 143467864) has the molecular formula C34H48N6O5 and a molecular weight of 620.80 g/mol. Its IUPAC name is ethane;methyl 2-[[5-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-6-(cyclohexylmethylcarbamoyl)-2-pyridinyl]oxy]acetate.
| Compound Name | ethane;methyl 2-[[5-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-6-(cyclohexylmethylcarbamoyl)-2-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 143467864 |
| Molecular Formula | C34H48N6O5 |
| Molecular Weight | 620.80 g/mol |
| Exact Mass | 620.37 |
| IUPAC Name | ethane;methyl 2-[[5-[[4-[[amino-[(Z)-2-aminoethenyl]amino]methyl]naphthalene-1-carbonyl]amino]-6-(cyclohexylmethylcarbamoyl)-2-pyridinyl]oxy]acetate |
| SMILES | CC.CC.COC(=O)COc1ccc(NC(=O)c2ccc(CN(N)/C=C\N)c3ccccc23)c(C(=O)NCC2CCCCC2)n1 |
| InChI | InChI=1S/C30H36N6O5.2C2H6/c1-40-27(37)19-41-26-14-13-25(28(35-26)30(39)33-17-20-7-3-2-4-8-20)34-29(38)24-12-11-21(18-36(32)16-15-31)22-9-5-6-10-23(22)24;2*1-2/h5-6,9-16,20H,2-4,7-8,17-19,31-32H2,1H3,(H,33,39)(H,34,38);2*1-2H3/b16-15-;; |
| InChIKey | VTTCJCGSXZQHPT-NDXGFPCWSA-N |
| XLogP | 5.51 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.80 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|