C23H25ClFN3O2 — CID 69366827
3-[3-(aminomethyl)-4-(4-fluorophenyl)-2-(2-methylpropyl)-1-oxoisoquinolin-6-yl]prop-2-enamide;hydrochloride (PubChem CID 69366827) has the molecular formula C23H25ClFN3O2 and a molecular weight of 429.92 g/mol. Its IUPAC name is 3-[3-(aminomethyl)-4-(4-fluorophenyl)-2-(2-methylpropyl)-1-oxoisoquinolin-6-yl]prop-2-enamide;hydrochloride.
| Compound Name | 3-[3-(aminomethyl)-4-(4-fluorophenyl)-2-(2-methylpropyl)-1-oxoisoquinolin-6-yl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 69366827 |
| Molecular Formula | C23H25ClFN3O2 |
| Molecular Weight | 429.92 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 3-[3-(aminomethyl)-4-(4-fluorophenyl)-2-(2-methylpropyl)-1-oxoisoquinolin-6-yl]prop-2-enamide;hydrochloride |
| SMILES | CC(C)Cn1c(CN)c(-c2ccc(F)cc2)c2cc(C=CC(N)=O)ccc2c1=O.Cl |
| InChI | InChI=1S/C23H24FN3O2.ClH/c1-14(2)13-27-20(12-25)22(16-5-7-17(24)8-6-16)19-11-15(4-10-21(26)28)3-9-18(19)23(27)29;/h3-11,14H,12-13,25H2,1-2H3,(H2,26,28);1H |
| InChIKey | DNPYJLALKHDACD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 91.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.92 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|