C21H21FN2O3 — CID 22176229
3-(aminomethyl)-4-(4-fluorophenyl)-2-(2-methylpropyl)-1-oxoisoquinoline-6-carboxylic acid (PubChem CID 22176229) has the molecular formula C21H21FN2O3 and a molecular weight of 368.41 g/mol. Its IUPAC name is 3-(aminomethyl)-4-(4-fluorophenyl)-2-(2-methylpropyl)-1-oxoisoquinoline-6-carboxylic acid.
| Compound Name | 3-(aminomethyl)-4-(4-fluorophenyl)-2-(2-methylpropyl)-1-oxoisoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 22176229 |
| Molecular Formula | C21H21FN2O3 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-(aminomethyl)-4-(4-fluorophenyl)-2-(2-methylpropyl)-1-oxoisoquinoline-6-carboxylic acid |
| SMILES | CC(C)Cn1c(CN)c(-c2ccc(F)cc2)c2cc(C(=O)O)ccc2c1=O |
| InChI | InChI=1S/C21H21FN2O3/c1-12(2)11-24-18(10-23)19(13-3-6-15(22)7-4-13)17-9-14(21(26)27)5-8-16(17)20(24)25/h3-9,12H,10-11,23H2,1-2H3,(H,26,27) |
| InChIKey | WDMRQZUSTKRWTJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |