C22H24N4O4 — CID 69363548
[6-(hydrazinecarbonyl)-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]methylcarbamic acid (PubChem CID 69363548) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is [6-(hydrazinecarbonyl)-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]methylcarbamic acid.
| Compound Name | [6-(hydrazinecarbonyl)-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]methylcarbamic acid |
|---|---|
| PubChem CID | 69363548 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [6-(hydrazinecarbonyl)-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]methylcarbamic acid |
| SMILES | CC(C)Cn1c(CNC(=O)O)c(-c2ccccc2)c2cc(C(=O)NN)ccc2c1=O |
| InChI | InChI=1S/C22H24N4O4/c1-13(2)12-26-18(11-24-22(29)30)19(14-6-4-3-5-7-14)17-10-15(20(27)25-23)8-9-16(17)21(26)28/h3-10,13,24H,11-12,23H2,1-2H3,(H,25,27)(H,29,30) |
| InChIKey | DUENBYOGPKNZEH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|