C36H33N3O3S — CID 22175953
9H-fluoren-9-ylmethyl N-[[6-carbamothioyl-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]methyl]carbamate (PubChem CID 22175953) has the molecular formula C36H33N3O3S and a molecular weight of 587.75 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[[6-carbamothioyl-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]methyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[[6-carbamothioyl-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 22175953 |
| Molecular Formula | C36H33N3O3S |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[[6-carbamothioyl-2-(2-methylpropyl)-1-oxo-4-phenylisoquinolin-3-yl]methyl]carbamate |
| SMILES | CC(C)Cn1c(CNC(=O)OCC2c3ccccc3-c3ccccc32)c(-c2ccccc2)c2cc(C(N)=S)ccc2c1=O |
| InChI | InChI=1S/C36H33N3O3S/c1-22(2)20-39-32(33(23-10-4-3-5-11-23)30-18-24(34(37)43)16-17-29(30)35(39)40)19-38-36(41)42-21-31-27-14-8-6-12-25(27)26-13-7-9-15-28(26)31/h3-18,22,31H,19-21H2,1-2H3,(H2,37,43)(H,38,41) |
| InChIKey | ZZSHAKGTUVTAPL-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|