C27H21NO4 — CID 138005991
5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]naphthalene-2-carboxylic acid (PubChem CID 138005991) has the molecular formula C27H21NO4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]naphthalene-2-carboxylic acid.
| Compound Name | 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 138005991 |
| Molecular Formula | C27H21NO4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 5-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]naphthalene-2-carboxylic acid |
| SMILES | O=C(NCc1cccc2cc(C(=O)O)ccc12)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H21NO4/c29-26(30)18-12-13-20-17(14-18)6-5-7-19(20)15-28-27(31)32-16-25-23-10-3-1-8-21(23)22-9-2-4-11-24(22)25/h1-14,25H,15-16H2,(H,28,31)(H,29,30) |
| InChIKey | PWFBFQPVURVVCG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |