C16H22N3O3S+ — CID 6937476
(2R)-2-(3-nitrophenyl)-3-(2-piperidin-1-ium-1-ylethyl)-1,3-thiazolidin-4-one (PubChem CID 6937476) has the molecular formula C16H22N3O3S+ and a molecular weight of 336.44 g/mol. Its IUPAC name is (2R)-2-(3-nitrophenyl)-3-(2-piperidin-1-ium-1-ylethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2R)-2-(3-nitrophenyl)-3-(2-piperidin-1-ium-1-ylethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6937476 |
| Molecular Formula | C16H22N3O3S+ |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (2R)-2-(3-nitrophenyl)-3-(2-piperidin-1-ium-1-ylethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS[C@H](c2cccc([N+](=O)[O-])c2)N1CC[NH+]1CCCCC1 |
| InChI | InChI=1S/C16H21N3O3S/c20-15-12-23-16(13-5-4-6-14(11-13)19(21)22)18(15)10-9-17-7-2-1-3-8-17/h4-6,11,16H,1-3,7-10,12H2/p+1/t16-/m1/s1 |
| InChIKey | PTTQZFIDRHTRRS-MRXNPFEDSA-O |
| XLogP | 1.24 |
| TPSA | 67.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|