C17H26N4O3S+2 — CID 6968997
(2S)-3-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-2-(3-nitrophenyl)-1,3-thiazolidin-4-one (PubChem CID 6968997) has the molecular formula C17H26N4O3S+2 and a molecular weight of 366.49 g/mol. Its IUPAC name is (2S)-3-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-2-(3-nitrophenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2S)-3-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-2-(3-nitrophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6968997 |
| Molecular Formula | C17H26N4O3S+2 |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (2S)-3-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-2-(3-nitrophenyl)-1,3-thiazolidin-4-one |
| SMILES | C[NH+]1CC[NH+](CCCN2C(=O)CS[C@H]2c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C17H24N4O3S/c1-18-8-10-19(11-9-18)6-3-7-20-16(22)13-25-17(20)14-4-2-5-15(12-14)21(23)24/h2,4-5,12,17H,3,6-11,13H2,1H3/p+2/t17-/m0/s1 |
| InChIKey | WEQYVLCSNSTNAK-KRWDZBQOSA-P |
| XLogP | -1.03 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|