C27H29N3O5 — CID 69375269
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-1-(3-methoxybenzoyl)pyrrolo[1,2-a]quinoline-3-carboxamide (PubChem CID 69375269) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-1-(3-methoxybenzoyl)pyrrolo[1,2-a]quinoline-3-carboxamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-1-(3-methoxybenzoyl)pyrrolo[1,2-a]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 69375269 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-1-(3-methoxybenzoyl)pyrrolo[1,2-a]quinoline-3-carboxamide |
| SMILES | COc1cccc(C(=O)c2cc(C(=O)NCCOCCOCCN)c3ccc4ccccc4n23)c1 |
| InChI | InChI=1S/C27H29N3O5/c1-33-21-7-4-6-20(17-21)26(31)25-18-22(27(32)29-12-14-35-16-15-34-13-11-28)24-10-9-19-5-2-3-8-23(19)30(24)25/h2-10,17-18H,11-16,28H2,1H3,(H,29,32) |
| InChIKey | VXALCTOIZQZOCH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|