About 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine
3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine (PubChem CID 69375800) has the molecular formula C19H14FN3
and a molecular weight of 303.34 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine |
| PubChem CID | 69375800 |
| Molecular Formula | C19H14FN3 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine |
| SMILES | Cc1ccc(-c2nc3ncccn3c2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H14FN3/c1-13-3-5-14(6-4-13)17-18(15-7-9-16(20)10-8-15)23-12-2-11-21-19(23)22-17/h2-12H,1H3 |
| InChIKey | RNXBNORLUTYBGK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine?
The IUPAC name of 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine (CID 69375800) is 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine.
What is the SMILES notation for 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine?
The canonical SMILES for 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine is Cc1ccc(-c2nc3ncccn3c2-c2ccc(F)cc2)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine?
The InChIKey is RNXBNORLUTYBGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14FN3/c1-13-3-5-14(6-4-13)17-18(15-7-9-16(20)10-8-15)23-12-2-11-21-19(23)22-17/h2-12H,1H3.
What are the key properties of 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine?
3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine has a molecular weight of 303.34 g/mol, XLogP of 4.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-2-(4-methylphenyl)imidazo[1,2-a]pyrimidine is sourced from PubChem (CID 69375800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).