C22H15ClFN5O3 — CID 69375849
7-[2-(4-chlorophenyl)ethyl]-6-[(3-fluoro-4-nitrophenoxy)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile (PubChem CID 69375849) has the molecular formula C22H15ClFN5O3 and a molecular weight of 451.85 g/mol. Its IUPAC name is 7-[2-(4-chlorophenyl)ethyl]-6-[(3-fluoro-4-nitrophenoxy)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile.
| Compound Name | 7-[2-(4-chlorophenyl)ethyl]-6-[(3-fluoro-4-nitrophenoxy)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 69375849 |
| Molecular Formula | C22H15ClFN5O3 |
| Molecular Weight | 451.85 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 7-[2-(4-chlorophenyl)ethyl]-6-[(3-fluoro-4-nitrophenoxy)methyl]pyrrolo[2,3-d]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1ncc2cc(COc3ccc([N+](=O)[O-])c(F)c3)n(CCc3ccc(Cl)cc3)c2n1 |
| InChI | InChI=1S/C22H15ClFN5O3/c23-16-3-1-14(2-4-16)7-8-28-17(9-15-12-26-21(11-25)27-22(15)28)13-32-18-5-6-20(29(30)31)19(24)10-18/h1-6,9-10,12H,7-8,13H2 |
| InChIKey | DRHCKCKEGNEVLC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 106.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|