C14H8F2N2O3 — CID 66996234
5-[(3,5-difluorophenyl)methoxy]-2-nitrobenzonitrile (PubChem CID 66996234) has the molecular formula C14H8F2N2O3 and a molecular weight of 290.23 g/mol. Its IUPAC name is 5-[(3,5-difluorophenyl)methoxy]-2-nitrobenzonitrile.
| Compound Name | 5-[(3,5-difluorophenyl)methoxy]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 66996234 |
| Molecular Formula | C14H8F2N2O3 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 5-[(3,5-difluorophenyl)methoxy]-2-nitrobenzonitrile |
| SMILES | N#Cc1cc(OCc2cc(F)cc(F)c2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8F2N2O3/c15-11-3-9(4-12(16)6-11)8-21-13-1-2-14(18(19)20)10(5-13)7-17/h1-6H,8H2 |
| InChIKey | WPJHFVDIEYHSCW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|