C15H23BrN2O2+2 — CID 6937713
[(2S)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] 4-bromobenzoate (PubChem CID 6937713) has the molecular formula C15H23BrN2O2+2 and a molecular weight of 343.26 g/mol. Its IUPAC name is [(2S)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] 4-bromobenzoate.
| Compound Name | [(2S)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 6937713 |
| Molecular Formula | C15H23BrN2O2+2 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [(2S)-1-(4-methylpiperazine-1,4-diium-1-yl)propan-2-yl] 4-bromobenzoate |
| SMILES | C[C@@H](C[NH+]1CC[NH+](C)CC1)OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H21BrN2O2/c1-12(11-18-9-7-17(2)8-10-18)20-15(19)13-3-5-14(16)6-4-13/h3-6,12H,7-11H2,1-2H3/p+2/t12-/m0/s1 |
| InChIKey | JCMDEBQRGWWTRO-LBPRGKRZSA-P |
| XLogP | -0.59 |
| TPSA | 35.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |