C12H16N4S — CID 69377507
N-(thiadiazolo[5,4-b]pyridin-6-ylmethyl)cyclohexanamine (PubChem CID 69377507) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is N-(thiadiazolo[5,4-b]pyridin-6-ylmethyl)cyclohexanamine.
| Compound Name | N-(thiadiazolo[5,4-b]pyridin-6-ylmethyl)cyclohexanamine |
|---|---|
| PubChem CID | 69377507 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-(thiadiazolo[5,4-b]pyridin-6-ylmethyl)cyclohexanamine |
| SMILES | c1nc2snnc2cc1CNC1CCCCC1 |
| InChI | InChI=1S/C12H16N4S/c1-2-4-10(5-3-1)13-7-9-6-11-12(14-8-9)17-16-15-11/h6,8,10,13H,1-5,7H2 |
| InChIKey | IIHUVKBNRHSDHC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |