C18H27N5O2 — CID 69377874
1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,2-b]pyrrole;4-(4-nitrophenyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole (PubChem CID 69377874) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,2-b]pyrrole;4-(4-nitrophenyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,2-b]pyrrole;4-(4-nitrophenyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 69377874 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,2-b]pyrrole;4-(4-nitrophenyl)-2,3,3a,5,6,6a-hexahydro-1H-pyrrolo[3,2-b]pyrrole |
| SMILES | C1CC2NCCC2N1.O=[N+]([O-])c1ccc(N2CCC3NCCC32)cc1 |
| InChI | InChI=1S/C12H15N3O2.C6H12N2/c16-15(17)10-3-1-9(2-4-10)14-8-6-11-12(14)5-7-13-11;1-3-7-6-2-4-8-5(1)6/h1-4,11-13H,5-8H2;5-8H,1-4H2 |
| InChIKey | QSZSCBOIPCBKDF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|