C21H25N5O2 — CID 69377909
(3R,4R)-4-[amino-[4-(3-methoxyanilino)quinazolin-5-yl]methyl]piperidin-3-ol (PubChem CID 69377909) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is (3R,4R)-4-[amino-[4-(3-methoxyanilino)quinazolin-5-yl]methyl]piperidin-3-ol.
| Compound Name | (3R,4R)-4-[amino-[4-(3-methoxyanilino)quinazolin-5-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 69377909 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (3R,4R)-4-[amino-[4-(3-methoxyanilino)quinazolin-5-yl]methyl]piperidin-3-ol |
| SMILES | COc1cccc(Nc2ncnc3cccc(C(N)[C@H]4CCNC[C@@H]4O)c23)c1 |
| InChI | InChI=1S/C21H25N5O2/c1-28-14-5-2-4-13(10-14)26-21-19-16(6-3-7-17(19)24-12-25-21)20(22)15-8-9-23-11-18(15)27/h2-7,10,12,15,18,20,23,27H,8-9,11,22H2,1H3,(H,24,25,26)/t15-,18-,20?/m0/s1 |
| InChIKey | ZCDKRITVJDTTOO-JBJJAQNESA-N |
| XLogP | 2.35 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |