C19H30N4O3S — CID 69379232
2-(3,3-diethoxypropoxy)-6-ethyl-4-piperazin-1-ylthieno[2,3-d]pyrimidine (PubChem CID 69379232) has the molecular formula C19H30N4O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is 2-(3,3-diethoxypropoxy)-6-ethyl-4-piperazin-1-ylthieno[2,3-d]pyrimidine.
| Compound Name | 2-(3,3-diethoxypropoxy)-6-ethyl-4-piperazin-1-ylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 69379232 |
| Molecular Formula | C19H30N4O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-(3,3-diethoxypropoxy)-6-ethyl-4-piperazin-1-ylthieno[2,3-d]pyrimidine |
| SMILES | CCOC(CCOc1nc(N2CCNCC2)c2cc(CC)sc2n1)OCC |
| InChI | InChI=1S/C19H30N4O3S/c1-4-14-13-15-17(23-10-8-20-9-11-23)21-19(22-18(15)27-14)26-12-7-16(24-5-2)25-6-3/h13,16,20H,4-12H2,1-3H3 |
| InChIKey | SKIGLSBKCBWTIL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|