C10H12N4O4S — CID 69379558
N-(furan-2-ylmethyl)-4-(methanesulfonamido)-1H-pyrazole-5-carboxamide (PubChem CID 69379558) has the molecular formula C10H12N4O4S and a molecular weight of 284.30 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(methanesulfonamido)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(methanesulfonamido)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 69379558 |
| Molecular Formula | C10H12N4O4S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(methanesulfonamido)-1H-pyrazole-5-carboxamide |
| SMILES | CS(=O)(=O)Nc1cn[nH]c1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C10H12N4O4S/c1-19(16,17)14-8-6-12-13-9(8)10(15)11-5-7-3-2-4-18-7/h2-4,6,14H,5H2,1H3,(H,11,15)(H,12,13) |
| InChIKey | RVIBSSXMHAPVQR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |