C16H16N4O5S — CID 69381406
N-(furan-2-ylmethyl)-4-[(4-methoxyphenyl)sulfonylamino]-1H-pyrazole-5-carboxamide (PubChem CID 69381406) has the molecular formula C16H16N4O5S and a molecular weight of 376.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[(4-methoxyphenyl)sulfonylamino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[(4-methoxyphenyl)sulfonylamino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 69381406 |
| Molecular Formula | C16H16N4O5S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[(4-methoxyphenyl)sulfonylamino]-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cn[nH]c2C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C16H16N4O5S/c1-24-11-4-6-13(7-5-11)26(22,23)20-14-10-18-19-15(14)16(21)17-9-12-3-2-8-25-12/h2-8,10,20H,9H2,1H3,(H,17,21)(H,18,19) |
| InChIKey | XKMBKFCEKJYXNZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |