C33H33N3O3 — CID 69379801
[4-benzhydryl-1-(3,3-diphenylpropanoyl)piperazin-2-yl] carbamate (PubChem CID 69379801) has the molecular formula C33H33N3O3 and a molecular weight of 519.65 g/mol. Its IUPAC name is [4-benzhydryl-1-(3,3-diphenylpropanoyl)piperazin-2-yl] carbamate.
| Compound Name | [4-benzhydryl-1-(3,3-diphenylpropanoyl)piperazin-2-yl] carbamate |
|---|---|
| PubChem CID | 69379801 |
| Molecular Formula | C33H33N3O3 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | [4-benzhydryl-1-(3,3-diphenylpropanoyl)piperazin-2-yl] carbamate |
| SMILES | NC(=O)OC1CN(C(c2ccccc2)c2ccccc2)CCN1C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H33N3O3/c34-33(38)39-31-24-35(32(27-17-9-3-10-18-27)28-19-11-4-12-20-28)21-22-36(31)30(37)23-29(25-13-5-1-6-14-25)26-15-7-2-8-16-26/h1-20,29,31-32H,21-24H2,(H2,34,38) |
| InChIKey | PLBDPSVGDOFKRO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |