2,4-dimethylbenzenesulfonic acid

C8H10O3S — CID 6938

IUPAC2,4-dimethylbenzenesulfonic acid
SMILESCc1ccc(S(=O)(=O)O)c(C)c1
InChIInChI=1S/C8H10O3S/c1-6-3-4-8(7(2)5-6)12(9,10)11/h3-5H,1-2H3,(H,9,10,11)
InChIKeyCHZLVSBMXZSPNN-UHFFFAOYSA-N
MW186.23 g/mol
LogP1.55
Rot. Bonds1

About 2,4-dimethylbenzenesulfonic acid

2,4-dimethylbenzenesulfonic acid (PubChem CID 6938) has the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. Its IUPAC name is 2,4-dimethylbenzenesulfonic acid.

Molecular Properties

Compound Name2,4-dimethylbenzenesulfonic acid
PubChem CID6938
Molecular FormulaC8H10O3S
Molecular Weight186.23 g/mol
Exact Mass186.04
IUPAC Name2,4-dimethylbenzenesulfonic acid
SMILESCc1ccc(S(=O)(=O)O)c(C)c1
InChIInChI=1S/C8H10O3S/c1-6-3-4-8(7(2)5-6)12(9,10)11/h3-5H,1-2H3,(H,9,10,11)
InChIKeyCHZLVSBMXZSPNN-UHFFFAOYSA-N
XLogP1.55
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.23
LogP ≤ 51.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,4-dimethylbenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

p-Toluenesulfonic acid
CID 6101
Sodium Dodecylbenzenesulfonate
CID 23662403
p-Toluenesulfonic acid monohydrate
CID 521998
4-Toluenesulfonyl chloride
CID 7397
Methyl p-toluenesulfonate
CID 6645
4-Ethylbenzenesulfonic acid
CID 7402
Sodium p-decylbenzenesulfonate
CID 23671430
(1,1'-Biphenyl)-4,4'-disulfonic acid
CID 79202
Ethyl p-methylbenzenesulfonate
CID 6638
2,5-Dimethylbenzenesulfonic acid
CID 11868
Sodium 4-styrenesulfonate
CID 3571582
p-Dodecylbenzenesulfonic acid
CID 8485

Frequently Asked Questions

What is the IUPAC name of 2,4-dimethylbenzenesulfonic acid?
The IUPAC name of 2,4-dimethylbenzenesulfonic acid (CID 6938) is 2,4-dimethylbenzenesulfonic acid.
What is the SMILES notation for 2,4-dimethylbenzenesulfonic acid?
The canonical SMILES for 2,4-dimethylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)c(C)c1.
What is the InChIKey of 2,4-dimethylbenzenesulfonic acid?
The InChIKey is CHZLVSBMXZSPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3S/c1-6-3-4-8(7(2)5-6)12(9,10)11/h3-5H,1-2H3,(H,9,10,11).
What are the key properties of 2,4-dimethylbenzenesulfonic acid?
2,4-dimethylbenzenesulfonic acid has a molecular weight of 186.23 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylbenzenesulfonic acid is sourced from PubChem (CID 6938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).