C9H7NO3 — CID 69380666
4-(hydroxymethyl)-1H-indole-2,3-dione (PubChem CID 69380666) has the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1H-indole-2,3-dione.
| Compound Name | 4-(hydroxymethyl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 69380666 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 4-(hydroxymethyl)-1H-indole-2,3-dione |
| SMILES | O=C1Nc2cccc(CO)c2C1=O |
| InChI | InChI=1S/C9H7NO3/c11-4-5-2-1-3-6-7(5)8(12)9(13)10-6/h1-3,11H,4H2,(H,10,12,13) |
| InChIKey | QSNIXJZFEINDFD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|