C8H16N4O2 — CID 69381577
3-nitro-2,4-di(propan-2-yl)-3H-1,2,4-triazole (PubChem CID 69381577) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-nitro-2,4-di(propan-2-yl)-3H-1,2,4-triazole.
| Compound Name | 3-nitro-2,4-di(propan-2-yl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69381577 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3-nitro-2,4-di(propan-2-yl)-3H-1,2,4-triazole |
| SMILES | CC(C)N1C=NN(C(C)C)C1[N+](=O)[O-] |
| InChI | InChI=1S/C8H16N4O2/c1-6(2)10-5-9-11(7(3)4)8(10)12(13)14/h5-8H,1-4H3 |
| InChIKey | ARKPBBOFDRSYCP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|