C6H9Cl3N4O2 — CID 69381761
3-nitro-2-propan-2-yl-4-(trichloromethyl)-3H-1,2,4-triazole (PubChem CID 69381761) has the molecular formula C6H9Cl3N4O2 and a molecular weight of 275.52 g/mol. Its IUPAC name is 3-nitro-2-propan-2-yl-4-(trichloromethyl)-3H-1,2,4-triazole.
| Compound Name | 3-nitro-2-propan-2-yl-4-(trichloromethyl)-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 69381761 |
| Molecular Formula | C6H9Cl3N4O2 |
| Molecular Weight | 275.52 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 3-nitro-2-propan-2-yl-4-(trichloromethyl)-3H-1,2,4-triazole |
| SMILES | CC(C)N1N=CN(C(Cl)(Cl)Cl)C1[N+](=O)[O-] |
| InChI | InChI=1S/C6H9Cl3N4O2/c1-4(2)12-5(13(14)15)11(3-10-12)6(7,8)9/h3-5H,1-2H3 |
| InChIKey | STGZTGDIONCRAX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|