C15H19N2O+ — CID 6938363
1-(1H-indol-3-yl)-2-piperidin-1-ium-1-ylethanone (PubChem CID 6938363) has the molecular formula C15H19N2O+ and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-piperidin-1-ium-1-ylethanone.
| Compound Name | 1-(1H-indol-3-yl)-2-piperidin-1-ium-1-ylethanone |
|---|---|
| PubChem CID | 6938363 |
| Molecular Formula | C15H19N2O+ |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-piperidin-1-ium-1-ylethanone |
| SMILES | O=C(C[NH+]1CCCCC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H18N2O/c18-15(11-17-8-4-1-5-9-17)13-10-16-14-7-3-2-6-12(13)14/h2-3,6-7,10,16H,1,4-5,8-9,11H2/p+1 |
| InChIKey | CDRQAUBCVZVLOJ-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |