C16H21N2O+ — CID 7358173
1-(1H-indol-3-yl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethanone (PubChem CID 7358173) has the molecular formula C16H21N2O+ and a molecular weight of 257.36 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethanone.
| Compound Name | 1-(1H-indol-3-yl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 7358173 |
| Molecular Formula | C16H21N2O+ |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-(1H-indol-3-yl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethanone |
| SMILES | C[C@@H]1CCC[NH+](CC(=O)c2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C16H20N2O/c1-12-5-4-8-18(10-12)11-16(19)14-9-17-15-7-3-2-6-13(14)15/h2-3,6-7,9,12,17H,4-5,8,10-11H2,1H3/p+1/t12-/m1/s1 |
| InChIKey | XQJWQRIAJQOCBB-GFCCVEGCSA-O |
| XLogP | 1.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |