C17H23N2O2+ — CID 7561918
1-(6-methoxy-1H-indol-3-yl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethanone (PubChem CID 7561918) has the molecular formula C17H23N2O2+ and a molecular weight of 287.38 g/mol. Its IUPAC name is 1-(6-methoxy-1H-indol-3-yl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethanone.
| Compound Name | 1-(6-methoxy-1H-indol-3-yl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 7561918 |
| Molecular Formula | C17H23N2O2+ |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 1-(6-methoxy-1H-indol-3-yl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]ethanone |
| SMILES | COc1ccc2c(C(=O)C[NH+]3CCC[C@@H](C)C3)c[nH]c2c1 |
| InChI | InChI=1S/C17H22N2O2/c1-12-4-3-7-19(10-12)11-17(20)15-9-18-16-8-13(21-2)5-6-14(15)16/h5-6,8-9,12,18H,3-4,7,10-11H2,1-2H3/p+1/t12-/m1/s1 |
| InChIKey | ILOXUXWHSPLVRM-GFCCVEGCSA-O |
| XLogP | 1.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |