C19H25N2O+ — CID 7409695
N-(2-methylnaphthalen-1-yl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide (PubChem CID 7409695) has the molecular formula C19H25N2O+ and a molecular weight of 297.42 g/mol. Its IUPAC name is N-(2-methylnaphthalen-1-yl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-methylnaphthalen-1-yl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 7409695 |
| Molecular Formula | C19H25N2O+ |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | N-(2-methylnaphthalen-1-yl)-2-[(3S)-3-methylpiperidin-1-ium-1-yl]acetamide |
| SMILES | Cc1ccc2ccccc2c1NC(=O)C[NH+]1CCC[C@H](C)C1 |
| InChI | InChI=1S/C19H24N2O/c1-14-6-5-11-21(12-14)13-18(22)20-19-15(2)9-10-16-7-3-4-8-17(16)19/h3-4,7-10,14H,5-6,11-13H2,1-2H3,(H,20,22)/p+1/t14-/m0/s1 |
| InChIKey | OPROEDYFLGAFMN-AWEZNQCLSA-O |
| XLogP | 2.40 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |