About 1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile
1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile (PubChem CID 69385879) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is 1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile.
Analyze 1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile?
The IUPAC name of 1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile (CID 69385879) is 1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile.
What is the SMILES notation for 1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile?
The canonical SMILES for 1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile is CCCCn1nnc(C#N)c1CC(C)(C)C.
What is the InChIKey of 1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile?
The InChIKey is IFYZRGVLYZLDOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4/c1-5-6-7-16-11(8-12(2,3)4)10(9-13)14-15-16/h5-8H2,1-4H3.
What are the key properties of 1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile?
1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile has a molecular weight of 220.32 g/mol, XLogP of 2.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-5-(2,2-dimethylpropyl)triazole-4-carbonitrile is sourced from PubChem (CID 69385879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).