About 5,5-dihexyltetrazole
5,5-dihexyltetrazole (PubChem CID 69386804) has the molecular formula C13H26N4
and a molecular weight of 238.38 g/mol. Its IUPAC name is 5,5-dihexyltetrazole.
Molecular Properties
| Compound Name | 5,5-dihexyltetrazole |
| PubChem CID | 69386804 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | 5,5-dihexyltetrazole |
| SMILES | CCCCCCC1(CCCCCC)N=NN=N1 |
| InChI | InChI=1S/C13H26N4/c1-3-5-7-9-11-13(14-16-17-15-13)12-10-8-6-4-2/h3-12H2,1-2H3 |
| InChIKey | NPXWVOQRUNIINE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dihexyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dihexyltetrazole?
The IUPAC name of 5,5-dihexyltetrazole (CID 69386804) is 5,5-dihexyltetrazole.
What is the SMILES notation for 5,5-dihexyltetrazole?
The canonical SMILES for 5,5-dihexyltetrazole is CCCCCCC1(CCCCCC)N=NN=N1.
What is the InChIKey of 5,5-dihexyltetrazole?
The InChIKey is NPXWVOQRUNIINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4/c1-3-5-7-9-11-13(14-16-17-15-13)12-10-8-6-4-2/h3-12H2,1-2H3.
What are the key properties of 5,5-dihexyltetrazole?
5,5-dihexyltetrazole has a molecular weight of 238.38 g/mol, XLogP of 5.46, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dihexyltetrazole is sourced from PubChem (CID 69386804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).