C19H18Cl2N4O5S — CID 69396589
N-[5-[4-(2-amino-2-hydroxyethyl)phenoxy]-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide (PubChem CID 69396589) has the molecular formula C19H18Cl2N4O5S and a molecular weight of 485.35 g/mol. Its IUPAC name is N-[5-[4-(2-amino-2-hydroxyethyl)phenoxy]-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide.
| Compound Name | N-[5-[4-(2-amino-2-hydroxyethyl)phenoxy]-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 69396589 |
| Molecular Formula | C19H18Cl2N4O5S |
| Molecular Weight | 485.35 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | N-[5-[4-(2-amino-2-hydroxyethyl)phenoxy]-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide |
| SMILES | COc1nc(Oc2ccc(CC(N)O)cc2)cnc1NS(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H18Cl2N4O5S/c1-29-19-18(25-31(27,28)14-4-2-3-13(20)17(14)21)23-10-16(24-19)30-12-7-5-11(6-8-12)9-15(22)26/h2-8,10,15,26H,9,22H2,1H3,(H,23,25) |
| InChIKey | QCIRSJCPUQKUSB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|