C19H17Cl3N4O5S — CID 87811784
N-[5-[4-(2-amino-2-hydroxyethyl)phenoxy]-6-chloro-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide (PubChem CID 87811784) has the molecular formula C19H17Cl3N4O5S and a molecular weight of 519.79 g/mol. Its IUPAC name is N-[5-[4-(2-amino-2-hydroxyethyl)phenoxy]-6-chloro-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide.
| Compound Name | N-[5-[4-(2-amino-2-hydroxyethyl)phenoxy]-6-chloro-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 87811784 |
| Molecular Formula | C19H17Cl3N4O5S |
| Molecular Weight | 519.79 g/mol |
| Exact Mass | 518.00 |
| IUPAC Name | N-[5-[4-(2-amino-2-hydroxyethyl)phenoxy]-6-chloro-3-methoxypyrazin-2-yl]-2,3-dichlorobenzenesulfonamide |
| SMILES | COc1nc(Oc2ccc(CC(N)O)cc2)c(Cl)nc1NS(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H17Cl3N4O5S/c1-30-19-17(26-32(28,29)13-4-2-3-12(20)15(13)21)24-16(22)18(25-19)31-11-7-5-10(6-8-11)9-14(23)27/h2-8,14,27H,9,23H2,1H3,(H,24,26) |
| InChIKey | KMTPRCVGOLPYES-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.79 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|