C16H23ClFN — CID 69397295
4-[1-(4-chloro-2-fluorophenyl)cyclobutyl]-N,N-dimethylbutan-1-amine (PubChem CID 69397295) has the molecular formula C16H23ClFN and a molecular weight of 283.82 g/mol. Its IUPAC name is 4-[1-(4-chloro-2-fluorophenyl)cyclobutyl]-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[1-(4-chloro-2-fluorophenyl)cyclobutyl]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 69397295 |
| Molecular Formula | C16H23ClFN |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 4-[1-(4-chloro-2-fluorophenyl)cyclobutyl]-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCC1(c2ccc(Cl)cc2F)CCC1 |
| InChI | InChI=1S/C16H23ClFN/c1-19(2)11-4-3-8-16(9-5-10-16)14-7-6-13(17)12-15(14)18/h6-7,12H,3-5,8-11H2,1-2H3 |
| InChIKey | YRWMHDSUODZXRK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|