C16H21F3NO2+ — CID 6939950
ethyl (2S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-ium-2-carboxylate (PubChem CID 6939950) has the molecular formula C16H21F3NO2+ and a molecular weight of 316.34 g/mol. Its IUPAC name is ethyl (2S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-ium-2-carboxylate.
| Compound Name | ethyl (2S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 6939950 |
| Molecular Formula | C16H21F3NO2+ |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | ethyl (2S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-1-ium-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCC[NH+]1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO2/c1-2-22-15(21)14-9-5-6-10-20(14)11-12-7-3-4-8-13(12)16(17,18)19/h3-4,7-8,14H,2,5-6,9-11H2,1H3/p+1/t14-/m0/s1 |
| InChIKey | MQODCIHAJKQGSP-AWEZNQCLSA-O |
| XLogP | 2.21 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |