About [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate
[3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate (PubChem CID 69400057) has the molecular formula C22H21N3O3
and a molecular weight of 375.43 g/mol. Its IUPAC name is [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate.
Molecular Properties
| Compound Name | [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate |
| PubChem CID | 69400057 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate |
| SMILES | Cc1cccc(C)c1NC(=O)c1cncc(-c2cccc(COC(N)=O)c2)c1 |
| InChI | InChI=1S/C22H21N3O3/c1-14-5-3-6-15(2)20(14)25-21(26)19-10-18(11-24-12-19)17-8-4-7-16(9-17)13-28-22(23)27/h3-12H,13H2,1-2H3,(H2,23,27)(H,25,26) |
| InChIKey | ZBDFAYAIRIWGGC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate?
The IUPAC name of [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate (CID 69400057) is [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate.
What is the SMILES notation for [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate?
The canonical SMILES for [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate is Cc1cccc(C)c1NC(=O)c1cncc(-c2cccc(COC(N)=O)c2)c1.
What is the InChIKey of [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate?
The InChIKey is ZBDFAYAIRIWGGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O3/c1-14-5-3-6-15(2)20(14)25-21(26)19-10-18(11-24-12-19)17-8-4-7-16(9-17)13-28-22(23)27/h3-12H,13H2,1-2H3,(H2,23,27)(H,25,26).
What are the key properties of [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate?
[3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate has a molecular weight of 375.43 g/mol, XLogP of 4.21, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-[(2,6-dimethylphenyl)carbamoyl]-3-pyridinyl]phenyl]methyl carbamate is sourced from PubChem (CID 69400057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).