About carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide
carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide (PubChem CID 143475247) has the molecular formula C24H23N3O3
and a molecular weight of 401.47 g/mol. Its IUPAC name is carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide |
| PubChem CID | 143475247 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide |
| SMILES | C=CNCc1ccc(-c2cncc(C(=O)Nc3c(C)cccc3C)c2)cc1.O=C=O |
| InChI | InChI=1S/C23H23N3O.CO2/c1-4-24-13-18-8-10-19(11-9-18)20-12-21(15-25-14-20)23(27)26-22-16(2)6-5-7-17(22)3;2-1-3/h4-12,14-15,24H,1,13H2,2-3H3,(H,26,27); |
| InChIKey | QTTVFUAJEZFEPT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide?
The IUPAC name of carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide (CID 143475247) is carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide.
What is the SMILES notation for carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide?
The canonical SMILES for carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide is C=CNCc1ccc(-c2cncc(C(=O)Nc3c(C)cccc3C)c2)cc1.O=C=O.
What is the InChIKey of carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide?
The InChIKey is QTTVFUAJEZFEPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O.CO2/c1-4-24-13-18-8-10-19(11-9-18)20-12-21(15-25-14-20)23(27)26-22-16(2)6-5-7-17(22)3;2-1-3/h4-12,14-15,24H,1,13H2,2-3H3,(H,26,27);.
What are the key properties of carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide?
carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide has a molecular weight of 401.47 g/mol, XLogP of 4.27, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;N-(2,6-dimethylphenyl)-5-[4-[(ethenylamino)methyl]phenyl]pyridine-3-carboxamide is sourced from PubChem (CID 143475247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).