C14H11F4N3O — CID 69401637
N-[2-amino-4-methyl-5-(trifluoromethyl)-3-pyridinyl]-2-fluorobenzamide (PubChem CID 69401637) has the molecular formula C14H11F4N3O and a molecular weight of 313.25 g/mol. Its IUPAC name is N-[2-amino-4-methyl-5-(trifluoromethyl)-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | N-[2-amino-4-methyl-5-(trifluoromethyl)-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 69401637 |
| Molecular Formula | C14H11F4N3O |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-[2-amino-4-methyl-5-(trifluoromethyl)-3-pyridinyl]-2-fluorobenzamide |
| SMILES | Cc1c(C(F)(F)F)cnc(N)c1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C14H11F4N3O/c1-7-9(14(16,17)18)6-20-12(19)11(7)21-13(22)8-4-2-3-5-10(8)15/h2-6H,1H3,(H2,19,20)(H,21,22) |
| InChIKey | CKSSFGAYDSRGBE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |