About 5-(oxan-3-yl)pentan-2-yl acetate
5-(oxan-3-yl)pentan-2-yl acetate (PubChem CID 69403351) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is 5-(oxan-3-yl)pentan-2-yl acetate.
Molecular Properties
| Compound Name | 5-(oxan-3-yl)pentan-2-yl acetate |
| PubChem CID | 69403351 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 5-(oxan-3-yl)pentan-2-yl acetate |
| SMILES | CC(=O)OC(C)CCCC1CCCOC1 |
| InChI | InChI=1S/C12H22O3/c1-10(15-11(2)13)5-3-6-12-7-4-8-14-9-12/h10,12H,3-9H2,1-2H3 |
| InChIKey | DWPORGLAYDTQKK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(oxan-3-yl)pentan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(oxan-3-yl)pentan-2-yl acetate?
The IUPAC name of 5-(oxan-3-yl)pentan-2-yl acetate (CID 69403351) is 5-(oxan-3-yl)pentan-2-yl acetate.
What is the SMILES notation for 5-(oxan-3-yl)pentan-2-yl acetate?
The canonical SMILES for 5-(oxan-3-yl)pentan-2-yl acetate is CC(=O)OC(C)CCCC1CCCOC1.
What is the InChIKey of 5-(oxan-3-yl)pentan-2-yl acetate?
The InChIKey is DWPORGLAYDTQKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-10(15-11(2)13)5-3-6-12-7-4-8-14-9-12/h10,12H,3-9H2,1-2H3.
What are the key properties of 5-(oxan-3-yl)pentan-2-yl acetate?
5-(oxan-3-yl)pentan-2-yl acetate has a molecular weight of 214.30 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(oxan-3-yl)pentan-2-yl acetate is sourced from PubChem (CID 69403351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).