C19H24ClNO — CID 69403889
4-[benzyl(ethyl)amino]-4-(3-chlorophenyl)butan-1-ol (PubChem CID 69403889) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is 4-[benzyl(ethyl)amino]-4-(3-chlorophenyl)butan-1-ol.
| Compound Name | 4-[benzyl(ethyl)amino]-4-(3-chlorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 69403889 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 4-[benzyl(ethyl)amino]-4-(3-chlorophenyl)butan-1-ol |
| SMILES | CCN(Cc1ccccc1)C(CCCO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H24ClNO/c1-2-21(15-16-8-4-3-5-9-16)19(12-7-13-22)17-10-6-11-18(20)14-17/h3-6,8-11,14,19,22H,2,7,12-13,15H2,1H3 |
| InChIKey | ADEYYAIRDNYAHL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |