C8H11N3O2 — CID 69404506
2-amino-4-pyridazin-4-ylbutanoic acid (PubChem CID 69404506) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-amino-4-pyridazin-4-ylbutanoic acid.
| Compound Name | 2-amino-4-pyridazin-4-ylbutanoic acid |
|---|---|
| PubChem CID | 69404506 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-amino-4-pyridazin-4-ylbutanoic acid |
| SMILES | NC(CCc1ccnnc1)C(=O)O |
| InChI | InChI=1S/C8H11N3O2/c9-7(8(12)13)2-1-6-3-4-10-11-5-6/h3-5,7H,1-2,9H2,(H,12,13) |
| InChIKey | JUKASKRPYDFOIR-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |