C22H31F3IN3O3S — CID 69406115
N-[1-(3-amino-5-methylhexanoyl)-2-iodopiperidin-3-yl]-N-cyclopropyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 69406115) has the molecular formula C22H31F3IN3O3S and a molecular weight of 601.47 g/mol. Its IUPAC name is N-[1-(3-amino-5-methylhexanoyl)-2-iodopiperidin-3-yl]-N-cyclopropyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[1-(3-amino-5-methylhexanoyl)-2-iodopiperidin-3-yl]-N-cyclopropyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 69406115 |
| Molecular Formula | C22H31F3IN3O3S |
| Molecular Weight | 601.47 g/mol |
| Exact Mass | 601.11 |
| IUPAC Name | N-[1-(3-amino-5-methylhexanoyl)-2-iodopiperidin-3-yl]-N-cyclopropyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)CC(N)CC(=O)N1CCCC(N(C2CC2)S(=O)(=O)c2cccc(C(F)(F)F)c2)C1I |
| InChI | InChI=1S/C22H31F3IN3O3S/c1-14(2)11-16(27)13-20(30)28-10-4-7-19(21(28)26)29(17-8-9-17)33(31,32)18-6-3-5-15(12-18)22(23,24)25/h3,5-6,12,14,16-17,19,21H,4,7-11,13,27H2,1-2H3 |
| InChIKey | VJAXZQVVTNAOPC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|