C22H22ClN5O4S — CID 69406681
[N'-[(4-amino-3-chloro-5-methylphenyl)methyl]-N-[3-(4-methoxyphenyl)-5-methyl-1,2-thiazole-4-carbonyl]carbamimidoyl]carbamic acid (PubChem CID 69406681) has the molecular formula C22H22ClN5O4S and a molecular weight of 487.97 g/mol. Its IUPAC name is [N'-[(4-amino-3-chloro-5-methylphenyl)methyl]-N-[3-(4-methoxyphenyl)-5-methyl-1,2-thiazole-4-carbonyl]carbamimidoyl]carbamic acid.
| Compound Name | [N'-[(4-amino-3-chloro-5-methylphenyl)methyl]-N-[3-(4-methoxyphenyl)-5-methyl-1,2-thiazole-4-carbonyl]carbamimidoyl]carbamic acid |
|---|---|
| PubChem CID | 69406681 |
| Molecular Formula | C22H22ClN5O4S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | [N'-[(4-amino-3-chloro-5-methylphenyl)methyl]-N-[3-(4-methoxyphenyl)-5-methyl-1,2-thiazole-4-carbonyl]carbamimidoyl]carbamic acid |
| SMILES | COc1ccc(-c2nsc(C)c2C(=O)N/C(=N/Cc2cc(C)c(N)c(Cl)c2)NC(=O)O)cc1 |
| InChI | InChI=1S/C22H22ClN5O4S/c1-11-8-13(9-16(23)18(11)24)10-25-21(27-22(30)31)26-20(29)17-12(2)33-28-19(17)14-4-6-15(32-3)7-5-14/h4-9H,10,24H2,1-3H3,(H,30,31)(H2,25,26,27,29) |
| InChIKey | BEGYGYAHDAYNPY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|