C24H23ClN4O7 — CID 91208227
3-[[3-[[[amino-[[3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]methylidene]amino]methyl]-5-chlorophenyl]methoxy]-3-oxopropanoic acid (PubChem CID 91208227) has the molecular formula C24H23ClN4O7 and a molecular weight of 514.92 g/mol. Its IUPAC name is 3-[[3-[[[amino-[[3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]methylidene]amino]methyl]-5-chlorophenyl]methoxy]-3-oxopropanoic acid.
| Compound Name | 3-[[3-[[[amino-[[3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]methylidene]amino]methyl]-5-chlorophenyl]methoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 91208227 |
| Molecular Formula | C24H23ClN4O7 |
| Molecular Weight | 514.92 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 3-[[3-[[[amino-[[3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]methylidene]amino]methyl]-5-chlorophenyl]methoxy]-3-oxopropanoic acid |
| SMILES | COc1ccc(-c2noc(C)c2C(=O)N/C(N)=N/Cc2cc(Cl)cc(COC(=O)CC(=O)O)c2)cc1 |
| InChI | InChI=1S/C24H23ClN4O7/c1-13-21(22(29-36-13)16-3-5-18(34-2)6-4-16)23(33)28-24(26)27-11-14-7-15(9-17(25)8-14)12-35-20(32)10-19(30)31/h3-9H,10-12H2,1-2H3,(H,30,31)(H3,26,27,28,33) |
| InChIKey | YJMHCSYBEGXTJG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 166.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.92 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|