C25H24N4O3 — CID 15941441
3-(4-ethoxyphenyl)-5-methyl-N-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]-1,2-oxazole-4-carboxamide (PubChem CID 15941441) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-5-methyl-N-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(4-ethoxyphenyl)-5-methyl-N-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 15941441 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-(4-ethoxyphenyl)-5-methyl-N-[N'-(naphthalen-1-ylmethyl)carbamimidoyl]-1,2-oxazole-4-carboxamide |
| SMILES | CCOc1ccc(-c2noc(C)c2C(=O)N/C(N)=N/Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H24N4O3/c1-3-31-20-13-11-18(12-14-20)23-22(16(2)32-29-23)24(30)28-25(26)27-15-19-9-6-8-17-7-4-5-10-21(17)19/h4-14H,3,15H2,1-2H3,(H3,26,27,28,30) |
| InChIKey | RIANKNIJHJKZHN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|